C15H11Br2NO — CID 43683009
N-(1-benzofuran-2-ylmethyl)-2,4-dibromoaniline (PubChem CID 43683009) has the molecular formula C15H11Br2NO and a molecular weight of 381.07 g/mol. Its IUPAC name is N-(1-benzofuran-2-ylmethyl)-2,4-dibromoaniline.
| Compound Name | N-(1-benzofuran-2-ylmethyl)-2,4-dibromoaniline |
|---|---|
| PubChem CID | 43683009 |
| Molecular Formula | C15H11Br2NO |
| Molecular Weight | 381.07 g/mol |
| Exact Mass | 378.92 |
| IUPAC Name | N-(1-benzofuran-2-ylmethyl)-2,4-dibromoaniline |
| SMILES | Brc1ccc(NCc2cc3ccccc3o2)c(Br)c1 |
| InChI | InChI=1S/C15H11Br2NO/c16-11-5-6-14(13(17)8-11)18-9-12-7-10-3-1-2-4-15(10)19-12/h1-8,18H,9H2 |
| InChIKey | JIFBTIREIFRXAH-UHFFFAOYSA-N |
| XLogP | 5.57 |
| TPSA | 25.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.07 |
| LogP ≤ 5 | 5.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |