C12H6F5NO2S — CID 115564080
5-[(2,3,4,5,6-pentafluoroanilino)methyl]thiophene-3-carboxylic acid (PubChem CID 115564080) has the molecular formula C12H6F5NO2S and a molecular weight of 323.24 g/mol. Its IUPAC name is 5-[(2,3,4,5,6-pentafluoroanilino)methyl]thiophene-3-carboxylic acid.
| Compound Name | 5-[(2,3,4,5,6-pentafluoroanilino)methyl]thiophene-3-carboxylic acid |
|---|---|
| PubChem CID | 115564080 |
| Molecular Formula | C12H6F5NO2S |
| Molecular Weight | 323.24 g/mol |
| Exact Mass | 323.00 |
| IUPAC Name | 5-[(2,3,4,5,6-pentafluoroanilino)methyl]thiophene-3-carboxylic acid |
| SMILES | O=C(O)c1csc(CNc2c(F)c(F)c(F)c(F)c2F)c1 |
| InChI | InChI=1S/C12H6F5NO2S/c13-6-7(14)9(16)11(10(17)8(6)15)18-2-5-1-4(3-21-5)12(19)20/h1,3,18H,2H2,(H,19,20) |
| InChIKey | RBCZREKQHGLGBT-UHFFFAOYSA-N |
| XLogP | 3.75 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.24 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|