C12H20N2O3S — CID 106145745
5-[[[3-(dimethylamino)-2-hydroxy-2-methylpropyl]amino]methyl]thiophene-3-carboxylic acid (PubChem CID 106145745) has the molecular formula C12H20N2O3S and a molecular weight of 272.37 g/mol. Its IUPAC name is 5-[[[3-(dimethylamino)-2-hydroxy-2-methylpropyl]amino]methyl]thiophene-3-carboxylic acid.
| Compound Name | 5-[[[3-(dimethylamino)-2-hydroxy-2-methylpropyl]amino]methyl]thiophene-3-carboxylic acid |
|---|---|
| PubChem CID | 106145745 |
| Molecular Formula | C12H20N2O3S |
| Molecular Weight | 272.37 g/mol |
| Exact Mass | 272.12 |
| IUPAC Name | 5-[[[3-(dimethylamino)-2-hydroxy-2-methylpropyl]amino]methyl]thiophene-3-carboxylic acid |
| SMILES | CN(C)CC(C)(O)CNCc1cc(C(=O)O)cs1 |
| InChI | InChI=1S/C12H20N2O3S/c1-12(17,8-14(2)3)7-13-5-10-4-9(6-18-10)11(15)16/h4,6,13,17H,5,7-8H2,1-3H3,(H,15,16) |
| InChIKey | ARRDVTKLAIZAMQ-UHFFFAOYSA-N |
| XLogP | 0.85 |
| TPSA | 72.80 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.37 |
| LogP ≤ 5 | 0.85 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |