C13H21N3O3 — CID 114150255
6-[[[3-(dimethylamino)-2-hydroxy-2-methylpropyl]amino]methyl]pyridine-2-carboxylic acid (PubChem CID 114150255) has the molecular formula C13H21N3O3 and a molecular weight of 267.33 g/mol. Its IUPAC name is 6-[[[3-(dimethylamino)-2-hydroxy-2-methylpropyl]amino]methyl]pyridine-2-carboxylic acid.
| Compound Name | 6-[[[3-(dimethylamino)-2-hydroxy-2-methylpropyl]amino]methyl]pyridine-2-carboxylic acid |
|---|---|
| PubChem CID | 114150255 |
| Molecular Formula | C13H21N3O3 |
| Molecular Weight | 267.33 g/mol |
| Exact Mass | 267.16 |
| IUPAC Name | 6-[[[3-(dimethylamino)-2-hydroxy-2-methylpropyl]amino]methyl]pyridine-2-carboxylic acid |
| SMILES | CN(C)CC(C)(O)CNCc1cccc(C(=O)O)n1 |
| InChI | InChI=1S/C13H21N3O3/c1-13(19,9-16(2)3)8-14-7-10-5-4-6-11(15-10)12(17)18/h4-6,14,19H,7-9H2,1-3H3,(H,17,18) |
| InChIKey | VVACVIDZWHPIMD-UHFFFAOYSA-N |
| XLogP | 0.18 |
| TPSA | 85.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.33 |
| LogP ≤ 5 | 0.18 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |