C12H22N4O — CID 106145720
1-(dimethylamino)-2-methyl-3-[(2-methylpyrimidin-4-yl)methylamino]propan-2-ol (PubChem CID 106145720) has the molecular formula C12H22N4O and a molecular weight of 238.33 g/mol. Its IUPAC name is 1-(dimethylamino)-2-methyl-3-[(2-methylpyrimidin-4-yl)methylamino]propan-2-ol.
| Compound Name | 1-(dimethylamino)-2-methyl-3-[(2-methylpyrimidin-4-yl)methylamino]propan-2-ol |
|---|---|
| PubChem CID | 106145720 |
| Molecular Formula | C12H22N4O |
| Molecular Weight | 238.33 g/mol |
| Exact Mass | 238.18 |
| IUPAC Name | 1-(dimethylamino)-2-methyl-3-[(2-methylpyrimidin-4-yl)methylamino]propan-2-ol |
| SMILES | Cc1nccc(CNCC(C)(O)CN(C)C)n1 |
| InChI | InChI=1S/C12H22N4O/c1-10-14-6-5-11(15-10)7-13-8-12(2,17)9-16(3)4/h5-6,13,17H,7-9H2,1-4H3 |
| InChIKey | LCALDAROTMPMHZ-UHFFFAOYSA-N |
| XLogP | 0.19 |
| TPSA | 61.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.33 |
| LogP ≤ 5 | 0.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |