C12H19NO4S — CID 114164019
5-[[(2-hydroxy-4-methoxy-2-methylbutyl)amino]methyl]thiophene-3-carboxylic acid (PubChem CID 114164019) has the molecular formula C12H19NO4S and a molecular weight of 273.35 g/mol. Its IUPAC name is 5-[[(2-hydroxy-4-methoxy-2-methylbutyl)amino]methyl]thiophene-3-carboxylic acid.
| Compound Name | 5-[[(2-hydroxy-4-methoxy-2-methylbutyl)amino]methyl]thiophene-3-carboxylic acid |
|---|---|
| PubChem CID | 114164019 |
| Molecular Formula | C12H19NO4S |
| Molecular Weight | 273.35 g/mol |
| Exact Mass | 273.10 |
| IUPAC Name | 5-[[(2-hydroxy-4-methoxy-2-methylbutyl)amino]methyl]thiophene-3-carboxylic acid |
| SMILES | COCCC(C)(O)CNCc1cc(C(=O)O)cs1 |
| InChI | InChI=1S/C12H19NO4S/c1-12(16,3-4-17-2)8-13-6-10-5-9(7-18-10)11(14)15/h5,7,13,16H,3-4,6,8H2,1-2H3,(H,14,15) |
| InChIKey | KVNKXSQRCHOQTP-UHFFFAOYSA-N |
| XLogP | 1.32 |
| TPSA | 78.79 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.35 |
| LogP ≤ 5 | 1.32 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |