C12H13NO2S2 — CID 81398371
5-[[[(1S)-1-thiophen-2-ylethyl]amino]methyl]thiophene-3-carboxylic acid (PubChem CID 81398371) has the molecular formula C12H13NO2S2 and a molecular weight of 267.38 g/mol. Its IUPAC name is 5-[[[(1S)-1-thiophen-2-ylethyl]amino]methyl]thiophene-3-carboxylic acid.
| Compound Name | 5-[[[(1S)-1-thiophen-2-ylethyl]amino]methyl]thiophene-3-carboxylic acid |
|---|---|
| PubChem CID | 81398371 |
| Molecular Formula | C12H13NO2S2 |
| Molecular Weight | 267.38 g/mol |
| Exact Mass | 267.04 |
| IUPAC Name | 5-[[[(1S)-1-thiophen-2-ylethyl]amino]methyl]thiophene-3-carboxylic acid |
| SMILES | C[C@H](NCc1cc(C(=O)O)cs1)c1cccs1 |
| InChI | InChI=1S/C12H13NO2S2/c1-8(11-3-2-4-16-11)13-6-10-5-9(7-17-10)12(14)15/h2-5,7-8,13H,6H2,1H3,(H,14,15)/t8-/m0/s1 |
| InChIKey | XPYQAEZGKZJEFM-QMMMGPOBSA-N |
| XLogP | 3.36 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.38 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |