C14H15BrN2OS — CID 79614684
5-[[1-(2-bromophenyl)ethylamino]methyl]thiophene-3-carboxamide (PubChem CID 79614684) has the molecular formula C14H15BrN2OS and a molecular weight of 339.26 g/mol. Its IUPAC name is 5-[[1-(2-bromophenyl)ethylamino]methyl]thiophene-3-carboxamide.
| Compound Name | 5-[[1-(2-bromophenyl)ethylamino]methyl]thiophene-3-carboxamide |
|---|---|
| PubChem CID | 79614684 |
| Molecular Formula | C14H15BrN2OS |
| Molecular Weight | 339.26 g/mol |
| Exact Mass | 338.01 |
| IUPAC Name | 5-[[1-(2-bromophenyl)ethylamino]methyl]thiophene-3-carboxamide |
| SMILES | CC(NCc1cc(C(N)=O)cs1)c1ccccc1Br |
| InChI | InChI=1S/C14H15BrN2OS/c1-9(12-4-2-3-5-13(12)15)17-7-11-6-10(8-19-11)14(16)18/h2-6,8-9,17H,7H2,1H3,(H2,16,18) |
| InChIKey | HJOGTSXXDBOUOW-UHFFFAOYSA-N |
| XLogP | 3.46 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.26 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |