C17H16BrNS2 — CID 43433659
1-(2-bromophenyl)-N-[(4-thiophen-2-ylthiophen-2-yl)methyl]ethanamine (PubChem CID 43433659) has the molecular formula C17H16BrNS2 and a molecular weight of 378.36 g/mol. Its IUPAC name is 1-(2-bromophenyl)-N-[(4-thiophen-2-ylthiophen-2-yl)methyl]ethanamine.
| Compound Name | 1-(2-bromophenyl)-N-[(4-thiophen-2-ylthiophen-2-yl)methyl]ethanamine |
|---|---|
| PubChem CID | 43433659 |
| Molecular Formula | C17H16BrNS2 |
| Molecular Weight | 378.36 g/mol |
| Exact Mass | 376.99 |
| IUPAC Name | 1-(2-bromophenyl)-N-[(4-thiophen-2-ylthiophen-2-yl)methyl]ethanamine |
| SMILES | CC(NCc1cc(-c2cccs2)cs1)c1ccccc1Br |
| InChI | InChI=1S/C17H16BrNS2/c1-12(15-5-2-3-6-16(15)18)19-10-14-9-13(11-21-14)17-7-4-8-20-17/h2-9,11-12,19H,10H2,1H3 |
| InChIKey | ATDUAKCPFYRCLA-UHFFFAOYSA-N |
| XLogP | 6.09 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.36 |
| LogP ≤ 5 | 6.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |