C17H16FNS2 — CID 81369744
(1R)-1-(3-fluorophenyl)-N-[(4-thiophen-2-ylthiophen-2-yl)methyl]ethanamine (PubChem CID 81369744) has the molecular formula C17H16FNS2 and a molecular weight of 317.45 g/mol. Its IUPAC name is (1R)-1-(3-fluorophenyl)-N-[(4-thiophen-2-ylthiophen-2-yl)methyl]ethanamine.
| Compound Name | (1R)-1-(3-fluorophenyl)-N-[(4-thiophen-2-ylthiophen-2-yl)methyl]ethanamine |
|---|---|
| PubChem CID | 81369744 |
| Molecular Formula | C17H16FNS2 |
| Molecular Weight | 317.45 g/mol |
| Exact Mass | 317.07 |
| IUPAC Name | (1R)-1-(3-fluorophenyl)-N-[(4-thiophen-2-ylthiophen-2-yl)methyl]ethanamine |
| SMILES | C[C@@H](NCc1cc(-c2cccs2)cs1)c1cccc(F)c1 |
| InChI | InChI=1S/C17H16FNS2/c1-12(13-4-2-5-15(18)8-13)19-10-16-9-14(11-21-16)17-6-3-7-20-17/h2-9,11-12,19H,10H2,1H3/t12-/m1/s1 |
| InChIKey | MTJFIICPEXBQFS-GFCCVEGCSA-N |
| XLogP | 5.47 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.45 |
| LogP ≤ 5 | 5.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |