C18H19NS2 — CID 43433657
1-(2-methylphenyl)-N-[(4-thiophen-2-ylthiophen-2-yl)methyl]ethanamine (PubChem CID 43433657) has the molecular formula C18H19NS2 and a molecular weight of 313.49 g/mol. Its IUPAC name is 1-(2-methylphenyl)-N-[(4-thiophen-2-ylthiophen-2-yl)methyl]ethanamine.
| Compound Name | 1-(2-methylphenyl)-N-[(4-thiophen-2-ylthiophen-2-yl)methyl]ethanamine |
|---|---|
| PubChem CID | 43433657 |
| Molecular Formula | C18H19NS2 |
| Molecular Weight | 313.49 g/mol |
| Exact Mass | 313.10 |
| IUPAC Name | 1-(2-methylphenyl)-N-[(4-thiophen-2-ylthiophen-2-yl)methyl]ethanamine |
| SMILES | Cc1ccccc1C(C)NCc1cc(-c2cccs2)cs1 |
| InChI | InChI=1S/C18H19NS2/c1-13-6-3-4-7-17(13)14(2)19-11-16-10-15(12-21-16)18-8-5-9-20-18/h3-10,12,14,19H,11H2,1-2H3 |
| InChIKey | NGWISISYCNYWGX-UHFFFAOYSA-N |
| XLogP | 5.64 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.49 |
| LogP ≤ 5 | 5.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |