C18H25NS2 — CID 81390018
(1S)-1-cycloheptyl-N-[(4-thiophen-2-ylthiophen-2-yl)methyl]ethanamine (PubChem CID 81390018) has the molecular formula C18H25NS2 and a molecular weight of 319.54 g/mol. Its IUPAC name is (1S)-1-cycloheptyl-N-[(4-thiophen-2-ylthiophen-2-yl)methyl]ethanamine.
| Compound Name | (1S)-1-cycloheptyl-N-[(4-thiophen-2-ylthiophen-2-yl)methyl]ethanamine |
|---|---|
| PubChem CID | 81390018 |
| Molecular Formula | C18H25NS2 |
| Molecular Weight | 319.54 g/mol |
| Exact Mass | 319.14 |
| IUPAC Name | (1S)-1-cycloheptyl-N-[(4-thiophen-2-ylthiophen-2-yl)methyl]ethanamine |
| SMILES | C[C@H](NCc1cc(-c2cccs2)cs1)C1CCCCCC1 |
| InChI | InChI=1S/C18H25NS2/c1-14(15-7-4-2-3-5-8-15)19-12-17-11-16(13-21-17)18-9-6-10-20-18/h6,9-11,13-15,19H,2-5,7-8,12H2,1H3/t14-/m0/s1 |
| InChIKey | YXNGTWIRSQLSDM-AWEZNQCLSA-N |
| XLogP | 5.93 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.54 |
| LogP ≤ 5 | 5.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |