C13H22ClNS — CID 69253507
1-cyclohexyl-N-(thiophen-2-ylmethyl)ethanamine;hydrochloride (PubChem CID 69253507) has the molecular formula C13H22ClNS and a molecular weight of 259.85 g/mol. Its IUPAC name is 1-cyclohexyl-N-(thiophen-2-ylmethyl)ethanamine;hydrochloride.
| Compound Name | 1-cyclohexyl-N-(thiophen-2-ylmethyl)ethanamine;hydrochloride |
|---|---|
| PubChem CID | 69253507 |
| Molecular Formula | C13H22ClNS |
| Molecular Weight | 259.85 g/mol |
| Exact Mass | 259.12 |
| IUPAC Name | 1-cyclohexyl-N-(thiophen-2-ylmethyl)ethanamine;hydrochloride |
| SMILES | CC(NCc1cccs1)C1CCCCC1.Cl |
| InChI | InChI=1S/C13H21NS.ClH/c1-11(12-6-3-2-4-7-12)14-10-13-8-5-9-15-13;/h5,8-9,11-12,14H,2-4,6-7,10H2,1H3;1H |
| InChIKey | DWPZNGYCTROALR-UHFFFAOYSA-N |
| XLogP | 4.23 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.85 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |