C12H16N2S — CID 62071589
2-cyclopentyl-2-(thiophen-2-ylmethylamino)acetonitrile (PubChem CID 62071589) has the molecular formula C12H16N2S and a molecular weight of 220.34 g/mol. Its IUPAC name is 2-cyclopentyl-2-(thiophen-2-ylmethylamino)acetonitrile.
| Compound Name | 2-cyclopentyl-2-(thiophen-2-ylmethylamino)acetonitrile |
|---|---|
| PubChem CID | 62071589 |
| Molecular Formula | C12H16N2S |
| Molecular Weight | 220.34 g/mol |
| Exact Mass | 220.10 |
| IUPAC Name | 2-cyclopentyl-2-(thiophen-2-ylmethylamino)acetonitrile |
| SMILES | N#CC(NCc1cccs1)C1CCCC1 |
| InChI | InChI=1S/C12H16N2S/c13-8-12(10-4-1-2-5-10)14-9-11-6-3-7-15-11/h3,6-7,10,12,14H,1-2,4-5,9H2 |
| InChIKey | AXLYCQOTCUPGPY-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 35.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.34 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |