C11H14N2S2 — CID 107132929
2-(thiolan-3-yl)-2-(thiophen-2-ylmethylamino)acetonitrile (PubChem CID 107132929) has the molecular formula C11H14N2S2 and a molecular weight of 238.38 g/mol. Its IUPAC name is 2-(thiolan-3-yl)-2-(thiophen-2-ylmethylamino)acetonitrile.
| Compound Name | 2-(thiolan-3-yl)-2-(thiophen-2-ylmethylamino)acetonitrile |
|---|---|
| PubChem CID | 107132929 |
| Molecular Formula | C11H14N2S2 |
| Molecular Weight | 238.38 g/mol |
| Exact Mass | 238.06 |
| IUPAC Name | 2-(thiolan-3-yl)-2-(thiophen-2-ylmethylamino)acetonitrile |
| SMILES | N#CC(NCc1cccs1)C1CCSC1 |
| InChI | InChI=1S/C11H14N2S2/c12-6-11(9-3-5-14-8-9)13-7-10-2-1-4-15-10/h1-2,4,9,11,13H,3,5,7-8H2 |
| InChIKey | XGNZUDWPMFAYEZ-UHFFFAOYSA-N |
| XLogP | 2.48 |
| TPSA | 35.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.38 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |