C16H21NOS2 — CID 103768976
1-(oxan-4-yl)-N-[(4-thiophen-2-ylthiophen-2-yl)methyl]ethanamine (PubChem CID 103768976) has the molecular formula C16H21NOS2 and a molecular weight of 307.48 g/mol. Its IUPAC name is 1-(oxan-4-yl)-N-[(4-thiophen-2-ylthiophen-2-yl)methyl]ethanamine.
| Compound Name | 1-(oxan-4-yl)-N-[(4-thiophen-2-ylthiophen-2-yl)methyl]ethanamine |
|---|---|
| PubChem CID | 103768976 |
| Molecular Formula | C16H21NOS2 |
| Molecular Weight | 307.48 g/mol |
| Exact Mass | 307.11 |
| IUPAC Name | 1-(oxan-4-yl)-N-[(4-thiophen-2-ylthiophen-2-yl)methyl]ethanamine |
| SMILES | CC(NCc1cc(-c2cccs2)cs1)C1CCOCC1 |
| InChI | InChI=1S/C16H21NOS2/c1-12(13-4-6-18-7-5-13)17-10-15-9-14(11-20-15)16-3-2-8-19-16/h2-3,8-9,11-13,17H,4-7,10H2,1H3 |
| InChIKey | ONSVHQANYJNHJH-UHFFFAOYSA-N |
| XLogP | 4.38 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.48 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |