C11H12ClNS2 — CID 79420654
N-[(4-chlorothiophen-2-yl)methyl]-1-thiophen-2-ylethanamine (PubChem CID 79420654) has the molecular formula C11H12ClNS2 and a molecular weight of 257.81 g/mol. Its IUPAC name is N-[(4-chlorothiophen-2-yl)methyl]-1-thiophen-2-ylethanamine.
| Compound Name | N-[(4-chlorothiophen-2-yl)methyl]-1-thiophen-2-ylethanamine |
|---|---|
| PubChem CID | 79420654 |
| Molecular Formula | C11H12ClNS2 |
| Molecular Weight | 257.81 g/mol |
| Exact Mass | 257.01 |
| IUPAC Name | N-[(4-chlorothiophen-2-yl)methyl]-1-thiophen-2-ylethanamine |
| SMILES | CC(NCc1cc(Cl)cs1)c1cccs1 |
| InChI | InChI=1S/C11H12ClNS2/c1-8(11-3-2-4-14-11)13-6-10-5-9(12)7-15-10/h2-5,7-8,13H,6H2,1H3 |
| InChIKey | DYAOIGQZJJMCPV-UHFFFAOYSA-N |
| XLogP | 4.31 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.81 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |