C8H11NOS — CID 141324975
5-propylthiophene-3-carboxamide (PubChem CID 141324975) has the molecular formula C8H11NOS and a molecular weight of 169.25 g/mol. Its IUPAC name is 5-propylthiophene-3-carboxamide.
| Compound Name | 5-propylthiophene-3-carboxamide |
|---|---|
| PubChem CID | 141324975 |
| Molecular Formula | C8H11NOS |
| Molecular Weight | 169.25 g/mol |
| Exact Mass | 169.06 |
| IUPAC Name | 5-propylthiophene-3-carboxamide |
| SMILES | CCCc1cc(C(N)=O)cs1 |
| InChI | InChI=1S/C8H11NOS/c1-2-3-7-4-6(5-11-7)8(9)10/h4-5H,2-3H2,1H3,(H2,9,10) |
| InChIKey | JICWMPUVQPWERU-UHFFFAOYSA-N |
| XLogP | 1.80 |
| TPSA | 43.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 169.25 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |