C29H31F6N5O7 — CID 175306405
[2-[(2R,4S)-2-[[(2S)-1-[(4-carbamimidoylphenyl)methylamino]-1-oxopropan-2-yl]carbamoyl]-4-phenylpiperidin-1-yl]acetyl] 2,2,2-trifluoroacetate;2,2,2-trifluoroacetic acid (PubChem CID 175306405) has the molecular formula C29H31F6N5O7 and a molecular weight of 675.58 g/mol. Its IUPAC name is [2-[(2R,4S)-2-[[(2S)-1-[(4-carbamimidoylphenyl)methylamino]-1-oxopropan-2-yl]carbamoyl]-4-phenylpiperidin-1-yl]acetyl] 2,2,2-trifluoroacetate;2,2,2-trifluoroacetic acid.
| Compound Name | [2-[(2R,4S)-2-[[(2S)-1-[(4-carbamimidoylphenyl)methylamino]-1-oxopropan-2-yl]carbamoyl]-4-phenylpiperidin-1-yl]acetyl] 2,2,2-trifluoroacetate;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 175306405 |
| Molecular Formula | C29H31F6N5O7 |
| Molecular Weight | 675.58 g/mol |
| Exact Mass | 675.21 |
| IUPAC Name | [2-[(2R,4S)-2-[[(2S)-1-[(4-carbamimidoylphenyl)methylamino]-1-oxopropan-2-yl]carbamoyl]-4-phenylpiperidin-1-yl]acetyl] 2,2,2-trifluoroacetate;2,2,2-trifluoroacetic acid |
| SMILES | O=C(O)C(F)(F)F.[H]/N=C(\N)c1ccc(CNC(=O)[C@H](C)NC(=O)[C@H]2C[C@@H](c3ccccc3)CCN2CC(=O)OC(=O)C(F)(F)F)cc1 |
| InChI | InChI=1S/C27H30F3N5O5.C2HF3O2/c1-16(24(37)33-14-17-7-9-19(10-8-17)23(31)32)34-25(38)21-13-20(18-5-3-2-4-6-18)11-12-35(21)15-22(36)40-26(39)27(28,29)30;3-2(4,5)1(6)7/h2-10,16,20-21H,11-15H2,1H3,(H3,31,32)(H,33,37)(H,34,38);(H,6,7)/t16-,20-,21+;/m0./s1 |
| InChIKey | HOBGISKGSLIYBQ-YVJLIMIGSA-N |
| XLogP | 2.61 |
| TPSA | 191.98 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 47 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 675.58 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|