C24H33Cl2N5O2 — CID 156653824
(2R,4R)-N-[(2S)-1-[(4-carbamimidoylphenyl)methylamino]-1-oxopropan-2-yl]-4-(3-methylphenyl)piperidine-2-carboxamide;dihydrochloride (PubChem CID 156653824) has the molecular formula C24H33Cl2N5O2 and a molecular weight of 494.47 g/mol. Its IUPAC name is (2R,4R)-N-[(2S)-1-[(4-carbamimidoylphenyl)methylamino]-1-oxopropan-2-yl]-4-(3-methylphenyl)piperidine-2-carboxamide;dihydrochloride.
| Compound Name | (2R,4R)-N-[(2S)-1-[(4-carbamimidoylphenyl)methylamino]-1-oxopropan-2-yl]-4-(3-methylphenyl)piperidine-2-carboxamide;dihydrochloride |
|---|---|
| PubChem CID | 156653824 |
| Molecular Formula | C24H33Cl2N5O2 |
| Molecular Weight | 494.47 g/mol |
| Exact Mass | 493.20 |
| IUPAC Name | (2R,4R)-N-[(2S)-1-[(4-carbamimidoylphenyl)methylamino]-1-oxopropan-2-yl]-4-(3-methylphenyl)piperidine-2-carboxamide;dihydrochloride |
| SMILES | Cl.Cl.[H]/N=C(\N)c1ccc(CNC(=O)[C@H](C)NC(=O)[C@H]2C[C@H](c3cccc(C)c3)CCN2)cc1 |
| InChI | InChI=1S/C24H31N5O2.2ClH/c1-15-4-3-5-19(12-15)20-10-11-27-21(13-20)24(31)29-16(2)23(30)28-14-17-6-8-18(9-7-17)22(25)26;;/h3-9,12,16,20-21,27H,10-11,13-14H2,1-2H3,(H3,25,26)(H,28,30)(H,29,31);2*1H/t16-,20+,21+;;/m0../s1 |
| InChIKey | SHFARUDMQBIEAF-ZDDDRALKSA-N |
| XLogP | 2.78 |
| TPSA | 120.10 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.47 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|