C23H31Cl2N5O3 — CID 156653749
(2R,4S)-N-[(2S)-1-[(4-carbamimidoylphenyl)methylamino]-1-oxopropan-2-yl]-4-(3-methoxyphenyl)pyrrolidine-2-carboxamide;dihydrochloride (PubChem CID 156653749) has the molecular formula C23H31Cl2N5O3 and a molecular weight of 496.44 g/mol. Its IUPAC name is (2R,4S)-N-[(2S)-1-[(4-carbamimidoylphenyl)methylamino]-1-oxopropan-2-yl]-4-(3-methoxyphenyl)pyrrolidine-2-carboxamide;dihydrochloride.
| Compound Name | (2R,4S)-N-[(2S)-1-[(4-carbamimidoylphenyl)methylamino]-1-oxopropan-2-yl]-4-(3-methoxyphenyl)pyrrolidine-2-carboxamide;dihydrochloride |
|---|---|
| PubChem CID | 156653749 |
| Molecular Formula | C23H31Cl2N5O3 |
| Molecular Weight | 496.44 g/mol |
| Exact Mass | 495.18 |
| IUPAC Name | (2R,4S)-N-[(2S)-1-[(4-carbamimidoylphenyl)methylamino]-1-oxopropan-2-yl]-4-(3-methoxyphenyl)pyrrolidine-2-carboxamide;dihydrochloride |
| SMILES | Cl.Cl.[H]/N=C(\N)c1ccc(CNC(=O)[C@H](C)NC(=O)[C@H]2C[C@@H](c3cccc(OC)c3)CN2)cc1 |
| InChI | InChI=1S/C23H29N5O3.2ClH/c1-14(22(29)27-12-15-6-8-16(9-7-15)21(24)25)28-23(30)20-11-18(13-26-20)17-4-3-5-19(10-17)31-2;;/h3-10,14,18,20,26H,11-13H2,1-2H3,(H3,24,25)(H,27,29)(H,28,30);2*1H/t14-,18+,20+;;/m0../s1 |
| InChIKey | SWPHVUSNSCYCLE-BTTVEBMESA-N |
| XLogP | 2.09 |
| TPSA | 129.33 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.44 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|