C23H29N5O2 — CID 146757301
(2R,4S)-N-[(2S)-1-[(4-carbamimidoylphenyl)methylamino]-1-oxopropan-2-yl]-4-(4-methylphenyl)pyrrolidine-2-carboxamide (PubChem CID 146757301) has the molecular formula C23H29N5O2 and a molecular weight of 407.52 g/mol. Its IUPAC name is (2R,4S)-N-[(2S)-1-[(4-carbamimidoylphenyl)methylamino]-1-oxopropan-2-yl]-4-(4-methylphenyl)pyrrolidine-2-carboxamide.
| Compound Name | (2R,4S)-N-[(2S)-1-[(4-carbamimidoylphenyl)methylamino]-1-oxopropan-2-yl]-4-(4-methylphenyl)pyrrolidine-2-carboxamide |
|---|---|
| PubChem CID | 146757301 |
| Molecular Formula | C23H29N5O2 |
| Molecular Weight | 407.52 g/mol |
| Exact Mass | 407.23 |
| IUPAC Name | (2R,4S)-N-[(2S)-1-[(4-carbamimidoylphenyl)methylamino]-1-oxopropan-2-yl]-4-(4-methylphenyl)pyrrolidine-2-carboxamide |
| SMILES | [H]/N=C(\N)c1ccc(CNC(=O)[C@H](C)NC(=O)[C@H]2C[C@@H](c3ccc(C)cc3)CN2)cc1 |
| InChI | InChI=1S/C23H29N5O2/c1-14-3-7-17(8-4-14)19-11-20(26-13-19)23(30)28-15(2)22(29)27-12-16-5-9-18(10-6-16)21(24)25/h3-10,15,19-20,26H,11-13H2,1-2H3,(H3,24,25)(H,27,29)(H,28,30)/t15-,19+,20+/m0/s1 |
| InChIKey | ROQIDAWMNFRQDS-CWFSZBLJSA-N |
| XLogP | 1.55 |
| TPSA | 120.10 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.52 |
| LogP ≤ 5 | 1.55 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|