C23H31Cl2N5O2 — CID 153286611
1-[(2S)-1-[(4-carbamimidoylphenyl)methylamino]-1-oxopropan-2-yl]-4-(4-methylphenyl)pyrrolidine-2-carboxamide;dihydrochloride (PubChem CID 153286611) has the molecular formula C23H31Cl2N5O2 and a molecular weight of 480.44 g/mol. Its IUPAC name is 1-[(2S)-1-[(4-carbamimidoylphenyl)methylamino]-1-oxopropan-2-yl]-4-(4-methylphenyl)pyrrolidine-2-carboxamide;dihydrochloride.
| Compound Name | 1-[(2S)-1-[(4-carbamimidoylphenyl)methylamino]-1-oxopropan-2-yl]-4-(4-methylphenyl)pyrrolidine-2-carboxamide;dihydrochloride |
|---|---|
| PubChem CID | 153286611 |
| Molecular Formula | C23H31Cl2N5O2 |
| Molecular Weight | 480.44 g/mol |
| Exact Mass | 479.19 |
| IUPAC Name | 1-[(2S)-1-[(4-carbamimidoylphenyl)methylamino]-1-oxopropan-2-yl]-4-(4-methylphenyl)pyrrolidine-2-carboxamide;dihydrochloride |
| SMILES | Cl.Cl.[H]/N=C(\N)c1ccc(CNC(=O)[C@H](C)N2CC(c3ccc(C)cc3)CC2C(N)=O)cc1 |
| InChI | InChI=1S/C23H29N5O2.2ClH/c1-14-3-7-17(8-4-14)19-11-20(22(26)29)28(13-19)15(2)23(30)27-12-16-5-9-18(10-6-16)21(24)25;;/h3-10,15,19-20H,11-13H2,1-2H3,(H3,24,25)(H2,26,29)(H,27,30);2*1H/t15-,19?,20?;;/m0../s1 |
| InChIKey | ZWPUYQMVJIXPFJ-UCAPEDMGSA-N |
| XLogP | 2.47 |
| TPSA | 125.30 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.44 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|