C21H23Cl2N3O3 — CID 153286845
1-[(2S)-1-[(3,5-dichloro-2-hydroxyphenyl)methylamino]-1-oxopropan-2-yl]-4-phenylpyrrolidine-2-carboxamide (PubChem CID 153286845) has the molecular formula C21H23Cl2N3O3 and a molecular weight of 436.34 g/mol. Its IUPAC name is 1-[(2S)-1-[(3,5-dichloro-2-hydroxyphenyl)methylamino]-1-oxopropan-2-yl]-4-phenylpyrrolidine-2-carboxamide.
| Compound Name | 1-[(2S)-1-[(3,5-dichloro-2-hydroxyphenyl)methylamino]-1-oxopropan-2-yl]-4-phenylpyrrolidine-2-carboxamide |
|---|---|
| PubChem CID | 153286845 |
| Molecular Formula | C21H23Cl2N3O3 |
| Molecular Weight | 436.34 g/mol |
| Exact Mass | 435.11 |
| IUPAC Name | 1-[(2S)-1-[(3,5-dichloro-2-hydroxyphenyl)methylamino]-1-oxopropan-2-yl]-4-phenylpyrrolidine-2-carboxamide |
| SMILES | C[C@@H](C(=O)NCc1cc(Cl)cc(Cl)c1O)N1CC(c2ccccc2)CC1C(N)=O |
| InChI | InChI=1S/C21H23Cl2N3O3/c1-12(21(29)25-10-14-7-16(22)9-17(23)19(14)27)26-11-15(8-18(26)20(24)28)13-5-3-2-4-6-13/h2-7,9,12,15,18,27H,8,10-11H2,1H3,(H2,24,28)(H,25,29)/t12-,15?,18?/m0/s1 |
| InChIKey | HKGLVZGBLOMYFW-RTYYOJRZSA-N |
| XLogP | 3.05 |
| TPSA | 95.66 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.34 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|