C18H30N6O3 — CID 158810034
(2S)-2-[[(2R)-2-amino-3-methylpentanoyl]amino]-N-[(4-carbamimidoylphenyl)methyl]butanediamide;molecular hydrogen (PubChem CID 158810034) has the molecular formula C18H30N6O3 and a molecular weight of 378.48 g/mol. Its IUPAC name is (2S)-2-[[(2R)-2-amino-3-methylpentanoyl]amino]-N-[(4-carbamimidoylphenyl)methyl]butanediamide;molecular hydrogen.
| Compound Name | (2S)-2-[[(2R)-2-amino-3-methylpentanoyl]amino]-N-[(4-carbamimidoylphenyl)methyl]butanediamide;molecular hydrogen |
|---|---|
| PubChem CID | 158810034 |
| Molecular Formula | C18H30N6O3 |
| Molecular Weight | 378.48 g/mol |
| Exact Mass | 378.24 |
| IUPAC Name | (2S)-2-[[(2R)-2-amino-3-methylpentanoyl]amino]-N-[(4-carbamimidoylphenyl)methyl]butanediamide;molecular hydrogen |
| SMILES | [H]/N=C(\N)c1ccc(CNC(=O)[C@H](CC(N)=O)NC(=O)[C@H](N)C(C)CC)cc1.[H][H] |
| InChI | InChI=1S/C18H28N6O3.H2/c1-3-10(2)15(20)18(27)24-13(8-14(19)25)17(26)23-9-11-4-6-12(7-5-11)16(21)22;/h4-7,10,13,15H,3,8-9,20H2,1-2H3,(H2,19,25)(H3,21,22)(H,23,26)(H,24,27);1H/t10?,13-,15+;/m0./s1 |
| InChIKey | IUOHVIALGCYNHB-IEUGCIQQSA-N |
| XLogP | -0.43 |
| TPSA | 177.18 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.48 |
| LogP ≤ 5 | -0.43 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|