C22H38N6O5S — CID 159038172
(2S)-N-[(4-carbamimidoylphenyl)methyl]-2-[[(2R)-3-methyl-2-(propylsulfonylamino)butanoyl]amino]hexanediamide;molecular hydrogen (PubChem CID 159038172) has the molecular formula C22H38N6O5S and a molecular weight of 498.65 g/mol. Its IUPAC name is (2S)-N-[(4-carbamimidoylphenyl)methyl]-2-[[(2R)-3-methyl-2-(propylsulfonylamino)butanoyl]amino]hexanediamide;molecular hydrogen.
| Compound Name | (2S)-N-[(4-carbamimidoylphenyl)methyl]-2-[[(2R)-3-methyl-2-(propylsulfonylamino)butanoyl]amino]hexanediamide;molecular hydrogen |
|---|---|
| PubChem CID | 159038172 |
| Molecular Formula | C22H38N6O5S |
| Molecular Weight | 498.65 g/mol |
| Exact Mass | 498.26 |
| IUPAC Name | (2S)-N-[(4-carbamimidoylphenyl)methyl]-2-[[(2R)-3-methyl-2-(propylsulfonylamino)butanoyl]amino]hexanediamide;molecular hydrogen |
| SMILES | [H]/N=C(\N)c1ccc(CNC(=O)[C@H](CCCC(N)=O)NC(=O)[C@H](NS(=O)(=O)CCC)C(C)C)cc1.[H][H] |
| InChI | InChI=1S/C22H36N6O5S.H2/c1-4-12-34(32,33)28-19(14(2)3)22(31)27-17(6-5-7-18(23)29)21(30)26-13-15-8-10-16(11-9-15)20(24)25;/h8-11,14,17,19,28H,4-7,12-13H2,1-3H3,(H2,23,29)(H3,24,25)(H,26,30)(H,27,31);1H/t17-,19+;/m0./s1 |
| InChIKey | JVSFPNQKGWBGMH-JUOYHRLASA-N |
| XLogP | 0.33 |
| TPSA | 197.33 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.65 |
| LogP ≤ 5 | 0.33 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|