C31H38N6O6S — CID 58594894
(2S)-N-[(4-carbamimidoylphenyl)methyl]-2-[[(2R)-2-(ethylsulfonylamino)-3-[4-(4-methoxyphenyl)phenyl]propanoyl]amino]pentanediamide (PubChem CID 58594894) has the molecular formula C31H38N6O6S and a molecular weight of 622.75 g/mol. Its IUPAC name is (2S)-N-[(4-carbamimidoylphenyl)methyl]-2-[[(2R)-2-(ethylsulfonylamino)-3-[4-(4-methoxyphenyl)phenyl]propanoyl]amino]pentanediamide.
| Compound Name | (2S)-N-[(4-carbamimidoylphenyl)methyl]-2-[[(2R)-2-(ethylsulfonylamino)-3-[4-(4-methoxyphenyl)phenyl]propanoyl]amino]pentanediamide |
|---|---|
| PubChem CID | 58594894 |
| Molecular Formula | C31H38N6O6S |
| Molecular Weight | 622.75 g/mol |
| Exact Mass | 622.26 |
| IUPAC Name | (2S)-N-[(4-carbamimidoylphenyl)methyl]-2-[[(2R)-2-(ethylsulfonylamino)-3-[4-(4-methoxyphenyl)phenyl]propanoyl]amino]pentanediamide |
| SMILES | [H]/N=C(\N)c1ccc(CNC(=O)[C@H](CCC(N)=O)NC(=O)[C@@H](Cc2ccc(-c3ccc(OC)cc3)cc2)NS(=O)(=O)CC)cc1 |
| InChI | InChI=1S/C31H38N6O6S/c1-3-44(41,42)37-27(18-20-4-8-22(9-5-20)23-12-14-25(43-2)15-13-23)31(40)36-26(16-17-28(32)38)30(39)35-19-21-6-10-24(11-7-21)29(33)34/h4-15,26-27,37H,3,16-19H2,1-2H3,(H2,32,38)(H3,33,34)(H,35,39)(H,36,40)/t26-,27+/m0/s1 |
| InChIKey | ZTKZIUGTLWUNEU-RRPNLBNLSA-N |
| XLogP | 1.56 |
| TPSA | 206.56 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 622.75 |
| LogP ≤ 5 | 1.56 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|