C22H25N5O3 — CID 11430688
N-[(4-carbamimidoylphenyl)methyl]-2-ethoxy-2-[3-(4-methoxyphenyl)pyrazol-1-yl]acetamide (PubChem CID 11430688) has the molecular formula C22H25N5O3 and a molecular weight of 407.47 g/mol. Its IUPAC name is N-[(4-carbamimidoylphenyl)methyl]-2-ethoxy-2-[3-(4-methoxyphenyl)pyrazol-1-yl]acetamide.
| Compound Name | N-[(4-carbamimidoylphenyl)methyl]-2-ethoxy-2-[3-(4-methoxyphenyl)pyrazol-1-yl]acetamide |
|---|---|
| PubChem CID | 11430688 |
| Molecular Formula | C22H25N5O3 |
| Molecular Weight | 407.47 g/mol |
| Exact Mass | 407.20 |
| IUPAC Name | N-[(4-carbamimidoylphenyl)methyl]-2-ethoxy-2-[3-(4-methoxyphenyl)pyrazol-1-yl]acetamide |
| SMILES | [H]/N=C(\N)c1ccc(CNC(=O)C(OCC)n2ccc(-c3ccc(OC)cc3)n2)cc1 |
| InChI | InChI=1S/C22H25N5O3/c1-3-30-22(21(28)25-14-15-4-6-17(7-5-15)20(23)24)27-13-12-19(26-27)16-8-10-18(29-2)11-9-16/h4-13,22H,3,14H2,1-2H3,(H3,23,24)(H,25,28) |
| InChIKey | NDENOFICPBFUCC-UHFFFAOYSA-N |
| XLogP | 2.69 |
| TPSA | 115.25 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.47 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|