C22H22F2N6O2 — CID 10457717
(2R)-2-[4-(2-aminopyrimidin-5-yl)-2,6-difluorophenyl]-N-[(4-carbamimidoylphenyl)methyl]-2-ethoxyacetamide (PubChem CID 10457717) has the molecular formula C22H22F2N6O2 and a molecular weight of 440.45 g/mol. Its IUPAC name is (2R)-2-[4-(2-aminopyrimidin-5-yl)-2,6-difluorophenyl]-N-[(4-carbamimidoylphenyl)methyl]-2-ethoxyacetamide.
| Compound Name | (2R)-2-[4-(2-aminopyrimidin-5-yl)-2,6-difluorophenyl]-N-[(4-carbamimidoylphenyl)methyl]-2-ethoxyacetamide |
|---|---|
| PubChem CID | 10457717 |
| Molecular Formula | C22H22F2N6O2 |
| Molecular Weight | 440.45 g/mol |
| Exact Mass | 440.18 |
| IUPAC Name | (2R)-2-[4-(2-aminopyrimidin-5-yl)-2,6-difluorophenyl]-N-[(4-carbamimidoylphenyl)methyl]-2-ethoxyacetamide |
| SMILES | [H]/N=C(\N)c1ccc(CNC(=O)[C@H](OCC)c2c(F)cc(-c3cnc(N)nc3)cc2F)cc1 |
| InChI | InChI=1S/C22H22F2N6O2/c1-2-32-19(21(31)28-9-12-3-5-13(6-4-12)20(25)26)18-16(23)7-14(8-17(18)24)15-10-29-22(27)30-11-15/h3-8,10-11,19H,2,9H2,1H3,(H3,25,26)(H,28,31)(H2,27,29,30)/t19-/m1/s1 |
| InChIKey | SVYZYCJKDLQLRI-LJQANCHMSA-N |
| XLogP | 2.68 |
| TPSA | 140.00 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.45 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|