C29H34F2N4O3 — CID 69290964
(2S)-N-[(4-carbamimidoylphenyl)methyl]-2-[4-[3-[3-(dimethylamino)propoxy]phenyl]-2,6-difluorophenyl]-2-ethoxyacetamide (PubChem CID 69290964) has the molecular formula C29H34F2N4O3 and a molecular weight of 524.61 g/mol. Its IUPAC name is (2S)-N-[(4-carbamimidoylphenyl)methyl]-2-[4-[3-[3-(dimethylamino)propoxy]phenyl]-2,6-difluorophenyl]-2-ethoxyacetamide.
| Compound Name | (2S)-N-[(4-carbamimidoylphenyl)methyl]-2-[4-[3-[3-(dimethylamino)propoxy]phenyl]-2,6-difluorophenyl]-2-ethoxyacetamide |
|---|---|
| PubChem CID | 69290964 |
| Molecular Formula | C29H34F2N4O3 |
| Molecular Weight | 524.61 g/mol |
| Exact Mass | 524.26 |
| IUPAC Name | (2S)-N-[(4-carbamimidoylphenyl)methyl]-2-[4-[3-[3-(dimethylamino)propoxy]phenyl]-2,6-difluorophenyl]-2-ethoxyacetamide |
| SMILES | [H]/N=C(\N)c1ccc(CNC(=O)[C@@H](OCC)c2c(F)cc(-c3cccc(OCCCN(C)C)c3)cc2F)cc1 |
| InChI | InChI=1S/C29H34F2N4O3/c1-4-37-27(29(36)34-18-19-9-11-20(12-10-19)28(32)33)26-24(30)16-22(17-25(26)31)21-7-5-8-23(15-21)38-14-6-13-35(2)3/h5,7-12,15-17,27H,4,6,13-14,18H2,1-3H3,(H3,32,33)(H,34,36)/t27-/m0/s1 |
| InChIKey | JALSKUDJMUTBTA-MHZLTWQESA-N |
| XLogP | 4.64 |
| TPSA | 100.67 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 524.61 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|