C24H23F2N3O3 — CID 69288877
(2S)-N-[(4-carbamimidoylphenyl)methyl]-2-(2,6-difluoro-4-phenoxyphenyl)-2-ethoxyacetamide (PubChem CID 69288877) has the molecular formula C24H23F2N3O3 and a molecular weight of 439.46 g/mol. Its IUPAC name is (2S)-N-[(4-carbamimidoylphenyl)methyl]-2-(2,6-difluoro-4-phenoxyphenyl)-2-ethoxyacetamide.
| Compound Name | (2S)-N-[(4-carbamimidoylphenyl)methyl]-2-(2,6-difluoro-4-phenoxyphenyl)-2-ethoxyacetamide |
|---|---|
| PubChem CID | 69288877 |
| Molecular Formula | C24H23F2N3O3 |
| Molecular Weight | 439.46 g/mol |
| Exact Mass | 439.17 |
| IUPAC Name | (2S)-N-[(4-carbamimidoylphenyl)methyl]-2-(2,6-difluoro-4-phenoxyphenyl)-2-ethoxyacetamide |
| SMILES | [H]/N=C(\N)c1ccc(CNC(=O)[C@@H](OCC)c2c(F)cc(Oc3ccccc3)cc2F)cc1 |
| InChI | InChI=1S/C24H23F2N3O3/c1-2-31-22(24(30)29-14-15-8-10-16(11-9-15)23(27)28)21-19(25)12-18(13-20(21)26)32-17-6-4-3-5-7-17/h3-13,22H,2,14H2,1H3,(H3,27,28)(H,29,30)/t22-/m0/s1 |
| InChIKey | MLAVZYOGIVHMJA-QFIPXVFZSA-N |
| XLogP | 4.44 |
| TPSA | 97.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.46 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|