C26H25F2N3O4 — CID 69290663
methyl 3-[4-[2-[(4-carbamimidoylphenyl)methylamino]-1-ethoxy-2-oxoethyl]-3,5-difluorophenyl]benzoate (PubChem CID 69290663) has the molecular formula C26H25F2N3O4 and a molecular weight of 481.50 g/mol. Its IUPAC name is methyl 3-[4-[2-[(4-carbamimidoylphenyl)methylamino]-1-ethoxy-2-oxoethyl]-3,5-difluorophenyl]benzoate.
| Compound Name | methyl 3-[4-[2-[(4-carbamimidoylphenyl)methylamino]-1-ethoxy-2-oxoethyl]-3,5-difluorophenyl]benzoate |
|---|---|
| PubChem CID | 69290663 |
| Molecular Formula | C26H25F2N3O4 |
| Molecular Weight | 481.50 g/mol |
| Exact Mass | 481.18 |
| IUPAC Name | methyl 3-[4-[2-[(4-carbamimidoylphenyl)methylamino]-1-ethoxy-2-oxoethyl]-3,5-difluorophenyl]benzoate |
| SMILES | [H]/N=C(\N)c1ccc(CNC(=O)C(OCC)c2c(F)cc(-c3cccc(C(=O)OC)c3)cc2F)cc1 |
| InChI | InChI=1S/C26H25F2N3O4/c1-3-35-23(25(32)31-14-15-7-9-16(10-8-15)24(29)30)22-20(27)12-19(13-21(22)28)17-5-4-6-18(11-17)26(33)34-2/h4-13,23H,3,14H2,1-2H3,(H3,29,30)(H,31,32) |
| InChIKey | BGEQIMFQNKODQN-UHFFFAOYSA-N |
| XLogP | 4.10 |
| TPSA | 114.50 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.50 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|