C25H33F2N3O6 — CID 69290681
(2S)-N-[(4-carbamimidoylphenyl)methyl]-2-[2,6-difluoro-3-[2-[2-(2-methoxyethoxy)ethoxy]ethoxy]phenyl]-2-ethoxyacetamide (PubChem CID 69290681) has the molecular formula C25H33F2N3O6 and a molecular weight of 509.55 g/mol. Its IUPAC name is (2S)-N-[(4-carbamimidoylphenyl)methyl]-2-[2,6-difluoro-3-[2-[2-(2-methoxyethoxy)ethoxy]ethoxy]phenyl]-2-ethoxyacetamide.
| Compound Name | (2S)-N-[(4-carbamimidoylphenyl)methyl]-2-[2,6-difluoro-3-[2-[2-(2-methoxyethoxy)ethoxy]ethoxy]phenyl]-2-ethoxyacetamide |
|---|---|
| PubChem CID | 69290681 |
| Molecular Formula | C25H33F2N3O6 |
| Molecular Weight | 509.55 g/mol |
| Exact Mass | 509.23 |
| IUPAC Name | (2S)-N-[(4-carbamimidoylphenyl)methyl]-2-[2,6-difluoro-3-[2-[2-(2-methoxyethoxy)ethoxy]ethoxy]phenyl]-2-ethoxyacetamide |
| SMILES | [H]/N=C(\N)c1ccc(CNC(=O)[C@@H](OCC)c2c(F)ccc(OCCOCCOCCOC)c2F)cc1 |
| InChI | InChI=1S/C25H33F2N3O6/c1-3-35-23(25(31)30-16-17-4-6-18(7-5-17)24(28)29)21-19(26)8-9-20(22(21)27)36-15-14-34-13-12-33-11-10-32-2/h4-9,23H,3,10-16H2,1-2H3,(H3,28,29)(H,30,31)/t23-/m0/s1 |
| InChIKey | NFIHEVWQSRVCKU-QHCPKHFHSA-N |
| XLogP | 2.70 |
| TPSA | 125.12 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 509.55 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|