C20H24ClF2N3O3 — CID 69290938
(2S)-N-[(4-carbamimidoylphenyl)methyl]-2-ethoxy-2-(4-ethoxy-2,6-difluorophenyl)acetamide;hydrochloride (PubChem CID 69290938) has the molecular formula C20H24ClF2N3O3 and a molecular weight of 427.88 g/mol. Its IUPAC name is (2S)-N-[(4-carbamimidoylphenyl)methyl]-2-ethoxy-2-(4-ethoxy-2,6-difluorophenyl)acetamide;hydrochloride.
| Compound Name | (2S)-N-[(4-carbamimidoylphenyl)methyl]-2-ethoxy-2-(4-ethoxy-2,6-difluorophenyl)acetamide;hydrochloride |
|---|---|
| PubChem CID | 69290938 |
| Molecular Formula | C20H24ClF2N3O3 |
| Molecular Weight | 427.88 g/mol |
| Exact Mass | 427.15 |
| IUPAC Name | (2S)-N-[(4-carbamimidoylphenyl)methyl]-2-ethoxy-2-(4-ethoxy-2,6-difluorophenyl)acetamide;hydrochloride |
| SMILES | Cl.[H]/N=C(\N)c1ccc(CNC(=O)[C@@H](OCC)c2c(F)cc(OCC)cc2F)cc1 |
| InChI | InChI=1S/C20H23F2N3O3.ClH/c1-3-27-14-9-15(21)17(16(22)10-14)18(28-4-2)20(26)25-11-12-5-7-13(8-6-12)19(23)24;/h5-10,18H,3-4,11H2,1-2H3,(H3,23,24)(H,25,26);1H/t18-;/m0./s1 |
| InChIKey | UJZXAUOEEMFAAH-FERBBOLQSA-N |
| XLogP | 3.46 |
| TPSA | 97.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.88 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|