C25H25F2N3O3 — CID 69292097
(2S)-N-[(4-carbamimidoylphenyl)methyl]-2-[2,6-difluoro-3-(3-methylphenoxy)phenyl]-2-ethoxyacetamide (PubChem CID 69292097) has the molecular formula C25H25F2N3O3 and a molecular weight of 453.49 g/mol. Its IUPAC name is (2S)-N-[(4-carbamimidoylphenyl)methyl]-2-[2,6-difluoro-3-(3-methylphenoxy)phenyl]-2-ethoxyacetamide.
| Compound Name | (2S)-N-[(4-carbamimidoylphenyl)methyl]-2-[2,6-difluoro-3-(3-methylphenoxy)phenyl]-2-ethoxyacetamide |
|---|---|
| PubChem CID | 69292097 |
| Molecular Formula | C25H25F2N3O3 |
| Molecular Weight | 453.49 g/mol |
| Exact Mass | 453.19 |
| IUPAC Name | (2S)-N-[(4-carbamimidoylphenyl)methyl]-2-[2,6-difluoro-3-(3-methylphenoxy)phenyl]-2-ethoxyacetamide |
| SMILES | [H]/N=C(\N)c1ccc(CNC(=O)[C@@H](OCC)c2c(F)ccc(Oc3cccc(C)c3)c2F)cc1 |
| InChI | InChI=1S/C25H25F2N3O3/c1-3-32-23(25(31)30-14-16-7-9-17(10-8-16)24(28)29)21-19(26)11-12-20(22(21)27)33-18-6-4-5-15(2)13-18/h4-13,23H,3,14H2,1-2H3,(H3,28,29)(H,30,31)/t23-/m0/s1 |
| InChIKey | DXYVEWHTRSZHQV-QHCPKHFHSA-N |
| XLogP | 4.74 |
| TPSA | 97.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.49 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|