C20H22FN3O5 — CID 69290849
methyl 2-[2-[2-[(4-carbamimidoylphenyl)methylamino]-1-methoxy-2-oxoethyl]-3-fluorophenoxy]acetate (PubChem CID 69290849) has the molecular formula C20H22FN3O5 and a molecular weight of 403.41 g/mol. Its IUPAC name is methyl 2-[2-[2-[(4-carbamimidoylphenyl)methylamino]-1-methoxy-2-oxoethyl]-3-fluorophenoxy]acetate.
| Compound Name | methyl 2-[2-[2-[(4-carbamimidoylphenyl)methylamino]-1-methoxy-2-oxoethyl]-3-fluorophenoxy]acetate |
|---|---|
| PubChem CID | 69290849 |
| Molecular Formula | C20H22FN3O5 |
| Molecular Weight | 403.41 g/mol |
| Exact Mass | 403.15 |
| IUPAC Name | methyl 2-[2-[2-[(4-carbamimidoylphenyl)methylamino]-1-methoxy-2-oxoethyl]-3-fluorophenoxy]acetate |
| SMILES | [H]/N=C(\N)c1ccc(CNC(=O)C(OC)c2c(F)cccc2OCC(=O)OC)cc1 |
| InChI | InChI=1S/C20H22FN3O5/c1-27-16(25)11-29-15-5-3-4-14(21)17(15)18(28-2)20(26)24-10-12-6-8-13(9-7-12)19(22)23/h3-9,18H,10-11H2,1-2H3,(H3,22,23)(H,24,26) |
| InChIKey | ZYZIUVXLUCKJMN-UHFFFAOYSA-N |
| XLogP | 1.67 |
| TPSA | 123.73 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.41 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|