C20H20F5N3O4 — CID 87937032
(2S)-N-[[4-carbamimidoyl-2-(2,2,2-trifluoroethoxy)phenyl]methyl]-2-(2,6-difluoro-4-methoxyphenyl)-2-methoxyacetamide (PubChem CID 87937032) has the molecular formula C20H20F5N3O4 and a molecular weight of 461.39 g/mol. Its IUPAC name is (2S)-N-[[4-carbamimidoyl-2-(2,2,2-trifluoroethoxy)phenyl]methyl]-2-(2,6-difluoro-4-methoxyphenyl)-2-methoxyacetamide.
| Compound Name | (2S)-N-[[4-carbamimidoyl-2-(2,2,2-trifluoroethoxy)phenyl]methyl]-2-(2,6-difluoro-4-methoxyphenyl)-2-methoxyacetamide |
|---|---|
| PubChem CID | 87937032 |
| Molecular Formula | C20H20F5N3O4 |
| Molecular Weight | 461.39 g/mol |
| Exact Mass | 461.14 |
| IUPAC Name | (2S)-N-[[4-carbamimidoyl-2-(2,2,2-trifluoroethoxy)phenyl]methyl]-2-(2,6-difluoro-4-methoxyphenyl)-2-methoxyacetamide |
| SMILES | [H]/N=C(\N)c1ccc(CNC(=O)[C@@H](OC)c2c(F)cc(OC)cc2F)c(OCC(F)(F)F)c1 |
| InChI | InChI=1S/C20H20F5N3O4/c1-30-12-6-13(21)16(14(22)7-12)17(31-2)19(29)28-8-11-4-3-10(18(26)27)5-15(11)32-9-20(23,24)25/h3-7,17H,8-9H2,1-2H3,(H3,26,27)(H,28,29)/t17-/m0/s1 |
| InChIKey | OFRPPBOGXOFVED-KRWDZBQOSA-N |
| XLogP | 3.20 |
| TPSA | 106.66 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.39 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|