C25H24ClFN4O4 — CID 58653977
N-[[4-carbamimidoyl-2-[2-[(2-fluorophenyl)methylamino]-2-oxoethoxy]phenyl]methyl]-3-chloro-5-methoxybenzamide (PubChem CID 58653977) has the molecular formula C25H24ClFN4O4 and a molecular weight of 498.94 g/mol. Its IUPAC name is N-[[4-carbamimidoyl-2-[2-[(2-fluorophenyl)methylamino]-2-oxoethoxy]phenyl]methyl]-3-chloro-5-methoxybenzamide.
| Compound Name | N-[[4-carbamimidoyl-2-[2-[(2-fluorophenyl)methylamino]-2-oxoethoxy]phenyl]methyl]-3-chloro-5-methoxybenzamide |
|---|---|
| PubChem CID | 58653977 |
| Molecular Formula | C25H24ClFN4O4 |
| Molecular Weight | 498.94 g/mol |
| Exact Mass | 498.15 |
| IUPAC Name | N-[[4-carbamimidoyl-2-[2-[(2-fluorophenyl)methylamino]-2-oxoethoxy]phenyl]methyl]-3-chloro-5-methoxybenzamide |
| SMILES | [H]/N=C(\N)c1ccc(CNC(=O)c2cc(Cl)cc(OC)c2)c(OCC(=O)NCc2ccccc2F)c1 |
| InChI | InChI=1S/C25H24ClFN4O4/c1-34-20-9-18(8-19(26)11-20)25(33)31-13-17-7-6-15(24(28)29)10-22(17)35-14-23(32)30-12-16-4-2-3-5-21(16)27/h2-11H,12-14H2,1H3,(H3,28,29)(H,30,32)(H,31,33) |
| InChIKey | AWZINQCSWSGJSG-UHFFFAOYSA-N |
| XLogP | 3.40 |
| TPSA | 126.53 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.94 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|