C22H25ClN4O7 — CID 58653987
2-[[2-[5-carbamimidoyl-2-[[[3-chloro-5-(2-methoxyethoxy)benzoyl]amino]methyl]phenoxy]acetyl]amino]acetic acid (PubChem CID 58653987) has the molecular formula C22H25ClN4O7 and a molecular weight of 492.92 g/mol. Its IUPAC name is 2-[[2-[5-carbamimidoyl-2-[[[3-chloro-5-(2-methoxyethoxy)benzoyl]amino]methyl]phenoxy]acetyl]amino]acetic acid.
| Compound Name | 2-[[2-[5-carbamimidoyl-2-[[[3-chloro-5-(2-methoxyethoxy)benzoyl]amino]methyl]phenoxy]acetyl]amino]acetic acid |
|---|---|
| PubChem CID | 58653987 |
| Molecular Formula | C22H25ClN4O7 |
| Molecular Weight | 492.92 g/mol |
| Exact Mass | 492.14 |
| IUPAC Name | 2-[[2-[5-carbamimidoyl-2-[[[3-chloro-5-(2-methoxyethoxy)benzoyl]amino]methyl]phenoxy]acetyl]amino]acetic acid |
| SMILES | [H]/N=C(\N)c1ccc(CNC(=O)c2cc(Cl)cc(OCCOC)c2)c(OCC(=O)NCC(=O)O)c1 |
| InChI | InChI=1S/C22H25ClN4O7/c1-32-4-5-33-17-7-15(6-16(23)9-17)22(31)27-10-14-3-2-13(21(24)25)8-18(14)34-12-19(28)26-11-20(29)30/h2-3,6-9H,4-5,10-12H2,1H3,(H3,24,25)(H,26,28)(H,27,31)(H,29,30) |
| InChIKey | QKKAZFLOPKUEQL-UHFFFAOYSA-N |
| XLogP | 1.16 |
| TPSA | 173.06 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.92 |
| LogP ≤ 5 | 1.16 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|