C22H20ClN5O3 — CID 58654008
N-[[2-(2-amino-2-oxoethoxy)-4-carbamimidoylphenyl]methyl]-3-chloro-5-pyridin-2-ylbenzamide (PubChem CID 58654008) has the molecular formula C22H20ClN5O3 and a molecular weight of 437.89 g/mol. Its IUPAC name is N-[[2-(2-amino-2-oxoethoxy)-4-carbamimidoylphenyl]methyl]-3-chloro-5-pyridin-2-ylbenzamide.
| Compound Name | N-[[2-(2-amino-2-oxoethoxy)-4-carbamimidoylphenyl]methyl]-3-chloro-5-pyridin-2-ylbenzamide |
|---|---|
| PubChem CID | 58654008 |
| Molecular Formula | C22H20ClN5O3 |
| Molecular Weight | 437.89 g/mol |
| Exact Mass | 437.13 |
| IUPAC Name | N-[[2-(2-amino-2-oxoethoxy)-4-carbamimidoylphenyl]methyl]-3-chloro-5-pyridin-2-ylbenzamide |
| SMILES | [H]/N=C(\N)c1ccc(CNC(=O)c2cc(Cl)cc(-c3ccccn3)c2)c(OCC(N)=O)c1 |
| InChI | InChI=1S/C22H20ClN5O3/c23-17-8-15(18-3-1-2-6-27-18)7-16(9-17)22(30)28-11-14-5-4-13(21(25)26)10-19(14)31-12-20(24)29/h1-10H,11-12H2,(H2,24,29)(H3,25,26)(H,28,30) |
| InChIKey | KFYPLDMWMSTNFB-UHFFFAOYSA-N |
| XLogP | 2.48 |
| TPSA | 144.18 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.89 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|