C25H29N5O8 — CID 11237829
acetic acid;N-[[2-(2-amino-2-oxoethoxy)-4-carbamimidoylphenyl]methyl]-2-ethoxy-2-(4-methyl-1,3-dioxoisoindol-2-yl)acetamide (PubChem CID 11237829) has the molecular formula C25H29N5O8 and a molecular weight of 527.53 g/mol. Its IUPAC name is acetic acid;N-[[2-(2-amino-2-oxoethoxy)-4-carbamimidoylphenyl]methyl]-2-ethoxy-2-(4-methyl-1,3-dioxoisoindol-2-yl)acetamide.
| Compound Name | acetic acid;N-[[2-(2-amino-2-oxoethoxy)-4-carbamimidoylphenyl]methyl]-2-ethoxy-2-(4-methyl-1,3-dioxoisoindol-2-yl)acetamide |
|---|---|
| PubChem CID | 11237829 |
| Molecular Formula | C25H29N5O8 |
| Molecular Weight | 527.53 g/mol |
| Exact Mass | 527.20 |
| IUPAC Name | acetic acid;N-[[2-(2-amino-2-oxoethoxy)-4-carbamimidoylphenyl]methyl]-2-ethoxy-2-(4-methyl-1,3-dioxoisoindol-2-yl)acetamide |
| SMILES | CC(=O)O.[H]/N=C(\N)c1ccc(CNC(=O)C(OCC)N2C(=O)c3cccc(C)c3C2=O)c(OCC(N)=O)c1 |
| InChI | InChI=1S/C23H25N5O6.C2H4O2/c1-3-33-23(28-21(31)15-6-4-5-12(2)18(15)22(28)32)20(30)27-10-14-8-7-13(19(25)26)9-16(14)34-11-17(24)29;1-2(3)4/h4-9,23H,3,10-11H2,1-2H3,(H2,24,29)(H3,25,26)(H,27,30);1H3,(H,3,4) |
| InChIKey | UGKKWFFVLFVRDC-UHFFFAOYSA-N |
| XLogP | 0.51 |
| TPSA | 215.20 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 527.53 |
| LogP ≤ 5 | 0.51 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|