C25H33N5O6 — CID 22064645
acetic acid;N-[[4-carbamimidoyl-2-(ethylamino)phenyl]methyl]-2-ethoxy-2-(6-methoxy-3-oxo-1H-isoindol-2-yl)acetamide (PubChem CID 22064645) has the molecular formula C25H33N5O6 and a molecular weight of 499.57 g/mol. Its IUPAC name is acetic acid;N-[[4-carbamimidoyl-2-(ethylamino)phenyl]methyl]-2-ethoxy-2-(6-methoxy-3-oxo-1H-isoindol-2-yl)acetamide.
| Compound Name | acetic acid;N-[[4-carbamimidoyl-2-(ethylamino)phenyl]methyl]-2-ethoxy-2-(6-methoxy-3-oxo-1H-isoindol-2-yl)acetamide |
|---|---|
| PubChem CID | 22064645 |
| Molecular Formula | C25H33N5O6 |
| Molecular Weight | 499.57 g/mol |
| Exact Mass | 499.24 |
| IUPAC Name | acetic acid;N-[[4-carbamimidoyl-2-(ethylamino)phenyl]methyl]-2-ethoxy-2-(6-methoxy-3-oxo-1H-isoindol-2-yl)acetamide |
| SMILES | CC(=O)O.[H]/N=C(\N)c1ccc(CNC(=O)C(OCC)N2Cc3cc(OC)ccc3C2=O)c(NCC)c1 |
| InChI | InChI=1S/C23H29N5O4.C2H4O2/c1-4-26-19-11-14(20(24)25)6-7-15(19)12-27-21(29)23(32-5-2)28-13-16-10-17(31-3)8-9-18(16)22(28)30;1-2(3)4/h6-11,23,26H,4-5,12-13H2,1-3H3,(H3,24,25)(H,27,29);1H3,(H,3,4) |
| InChIKey | BSUSTKQHVQPRJY-UHFFFAOYSA-N |
| XLogP | 2.14 |
| TPSA | 167.07 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.57 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|