C32H37FN6O3 — CID 11227454
N-[[4-carbamimidoyl-2-[(2-fluorophenyl)methylamino]phenyl]methyl]-2-ethoxy-2-(3-oxo-5-piperidin-1-yl-1H-isoindol-2-yl)acetamide (PubChem CID 11227454) has the molecular formula C32H37FN6O3 and a molecular weight of 572.69 g/mol. Its IUPAC name is N-[[4-carbamimidoyl-2-[(2-fluorophenyl)methylamino]phenyl]methyl]-2-ethoxy-2-(3-oxo-5-piperidin-1-yl-1H-isoindol-2-yl)acetamide.
| Compound Name | N-[[4-carbamimidoyl-2-[(2-fluorophenyl)methylamino]phenyl]methyl]-2-ethoxy-2-(3-oxo-5-piperidin-1-yl-1H-isoindol-2-yl)acetamide |
|---|---|
| PubChem CID | 11227454 |
| Molecular Formula | C32H37FN6O3 |
| Molecular Weight | 572.69 g/mol |
| Exact Mass | 572.29 |
| IUPAC Name | N-[[4-carbamimidoyl-2-[(2-fluorophenyl)methylamino]phenyl]methyl]-2-ethoxy-2-(3-oxo-5-piperidin-1-yl-1H-isoindol-2-yl)acetamide |
| SMILES | [H]/N=C(\N)c1ccc(CNC(=O)C(OCC)N2Cc3ccc(N4CCCCC4)cc3C2=O)c(NCc2ccccc2F)c1 |
| InChI | InChI=1S/C32H37FN6O3/c1-2-42-32(39-20-24-12-13-25(17-26(24)31(39)41)38-14-6-3-7-15-38)30(40)37-19-23-11-10-21(29(34)35)16-28(23)36-18-22-8-4-5-9-27(22)33/h4-5,8-13,16-17,32,36H,2-3,6-7,14-15,18-20H2,1H3,(H3,34,35)(H,37,40) |
| InChIKey | YQJVJZAUMMTASJ-UHFFFAOYSA-N |
| XLogP | 4.35 |
| TPSA | 123.78 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 572.69 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|