C29H31ClFN5O5 — CID 11410651
acetic acid;N-[[4-carbamimidoyl-2-[(2-fluorophenyl)methylamino]phenyl]methyl]-2-(5-chloro-3-oxo-1H-isoindol-2-yl)-2-ethoxyacetamide (PubChem CID 11410651) has the molecular formula C29H31ClFN5O5 and a molecular weight of 584.05 g/mol. Its IUPAC name is acetic acid;N-[[4-carbamimidoyl-2-[(2-fluorophenyl)methylamino]phenyl]methyl]-2-(5-chloro-3-oxo-1H-isoindol-2-yl)-2-ethoxyacetamide.
| Compound Name | acetic acid;N-[[4-carbamimidoyl-2-[(2-fluorophenyl)methylamino]phenyl]methyl]-2-(5-chloro-3-oxo-1H-isoindol-2-yl)-2-ethoxyacetamide |
|---|---|
| PubChem CID | 11410651 |
| Molecular Formula | C29H31ClFN5O5 |
| Molecular Weight | 584.05 g/mol |
| Exact Mass | 583.20 |
| IUPAC Name | acetic acid;N-[[4-carbamimidoyl-2-[(2-fluorophenyl)methylamino]phenyl]methyl]-2-(5-chloro-3-oxo-1H-isoindol-2-yl)-2-ethoxyacetamide |
| SMILES | CC(=O)O.[H]/N=C(\N)c1ccc(CNC(=O)C(OCC)N2Cc3ccc(Cl)cc3C2=O)c(NCc2ccccc2F)c1 |
| InChI | InChI=1S/C27H27ClFN5O3.C2H4O2/c1-2-37-27(34-15-19-9-10-20(28)12-21(19)26(34)36)25(35)33-14-18-8-7-16(24(30)31)11-23(18)32-13-17-5-3-4-6-22(17)29;1-2(3)4/h3-12,27,32H,2,13-15H2,1H3,(H3,30,31)(H,33,35);1H3,(H,3,4) |
| InChIKey | HJFNSINWDSLYLF-UHFFFAOYSA-N |
| XLogP | 4.10 |
| TPSA | 157.84 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 584.05 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|