C32H40N6O6 — CID 11227239
acetic acid;N-[[4-carbamimidoyl-2-[[2-(ethylamino)phenyl]methylamino]phenyl]methyl]-2-ethoxy-2-(6-methoxy-3-oxo-1H-isoindol-2-yl)acetamide (PubChem CID 11227239) has the molecular formula C32H40N6O6 and a molecular weight of 604.71 g/mol. Its IUPAC name is acetic acid;N-[[4-carbamimidoyl-2-[[2-(ethylamino)phenyl]methylamino]phenyl]methyl]-2-ethoxy-2-(6-methoxy-3-oxo-1H-isoindol-2-yl)acetamide.
| Compound Name | acetic acid;N-[[4-carbamimidoyl-2-[[2-(ethylamino)phenyl]methylamino]phenyl]methyl]-2-ethoxy-2-(6-methoxy-3-oxo-1H-isoindol-2-yl)acetamide |
|---|---|
| PubChem CID | 11227239 |
| Molecular Formula | C32H40N6O6 |
| Molecular Weight | 604.71 g/mol |
| Exact Mass | 604.30 |
| IUPAC Name | acetic acid;N-[[4-carbamimidoyl-2-[[2-(ethylamino)phenyl]methylamino]phenyl]methyl]-2-ethoxy-2-(6-methoxy-3-oxo-1H-isoindol-2-yl)acetamide |
| SMILES | CC(=O)O.[H]/N=C(\N)c1ccc(CNC(=O)C(OCC)N2Cc3cc(OC)ccc3C2=O)c(NCc2ccccc2NCC)c1 |
| InChI | InChI=1S/C30H36N6O4.C2H4O2/c1-4-33-25-9-7-6-8-20(25)16-34-26-15-19(27(31)32)10-11-21(26)17-35-28(37)30(40-5-2)36-18-22-14-23(39-3)12-13-24(22)29(36)38;1-2(3)4/h6-15,30,33-34H,4-5,16-18H2,1-3H3,(H3,31,32)(H,35,37);1H3,(H,3,4) |
| InChIKey | SLNBFWCIZHHAMN-UHFFFAOYSA-N |
| XLogP | 3.75 |
| TPSA | 179.10 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 604.71 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|