C23H28N4O5 — CID 11305250
acetic acid;N-[(4-carbamimidoylphenyl)methyl]-2-ethoxy-2-(4-methyl-3-oxo-1H-isoindol-2-yl)acetamide (PubChem CID 11305250) has the molecular formula C23H28N4O5 and a molecular weight of 440.50 g/mol. Its IUPAC name is acetic acid;N-[(4-carbamimidoylphenyl)methyl]-2-ethoxy-2-(4-methyl-3-oxo-1H-isoindol-2-yl)acetamide.
| Compound Name | acetic acid;N-[(4-carbamimidoylphenyl)methyl]-2-ethoxy-2-(4-methyl-3-oxo-1H-isoindol-2-yl)acetamide |
|---|---|
| PubChem CID | 11305250 |
| Molecular Formula | C23H28N4O5 |
| Molecular Weight | 440.50 g/mol |
| Exact Mass | 440.21 |
| IUPAC Name | acetic acid;N-[(4-carbamimidoylphenyl)methyl]-2-ethoxy-2-(4-methyl-3-oxo-1H-isoindol-2-yl)acetamide |
| SMILES | CC(=O)O.[H]/N=C(\N)c1ccc(CNC(=O)C(OCC)N2Cc3cccc(C)c3C2=O)cc1 |
| InChI | InChI=1S/C21H24N4O3.C2H4O2/c1-3-28-21(25-12-16-6-4-5-13(2)17(16)20(25)27)19(26)24-11-14-7-9-15(10-8-14)18(22)23;1-2(3)4/h4-10,21H,3,11-12H2,1-2H3,(H3,22,23)(H,24,26);1H3,(H,3,4) |
| InChIKey | HEOLTRSLQRIVRT-UHFFFAOYSA-N |
| XLogP | 2.00 |
| TPSA | 145.81 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.50 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|