C20H20N4O4 — CID 11282109
N-[(4-carbamimidoylphenyl)methyl]-2-(1,3-dioxoisoindol-2-yl)-2-ethoxyacetamide (PubChem CID 11282109) has the molecular formula C20H20N4O4 and a molecular weight of 380.40 g/mol. Its IUPAC name is N-[(4-carbamimidoylphenyl)methyl]-2-(1,3-dioxoisoindol-2-yl)-2-ethoxyacetamide.
| Compound Name | N-[(4-carbamimidoylphenyl)methyl]-2-(1,3-dioxoisoindol-2-yl)-2-ethoxyacetamide |
|---|---|
| PubChem CID | 11282109 |
| Molecular Formula | C20H20N4O4 |
| Molecular Weight | 380.40 g/mol |
| Exact Mass | 380.15 |
| IUPAC Name | N-[(4-carbamimidoylphenyl)methyl]-2-(1,3-dioxoisoindol-2-yl)-2-ethoxyacetamide |
| SMILES | [H]/N=C(\N)c1ccc(CNC(=O)C(OCC)N2C(=O)c3ccccc3C2=O)cc1 |
| InChI | InChI=1S/C20H20N4O4/c1-2-28-20(24-18(26)14-5-3-4-6-15(14)19(24)27)17(25)23-11-12-7-9-13(10-8-12)16(21)22/h3-10,20H,2,11H2,1H3,(H3,21,22)(H,23,25) |
| InChIKey | HPSAJJRAZGPXNN-UHFFFAOYSA-N |
| XLogP | 1.25 |
| TPSA | 125.58 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.40 |
| LogP ≤ 5 | 1.25 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|