C20H22N6O2 — CID 11419248
N-[(4-carbamimidoylphenyl)methyl]-2-ethoxy-2-(3-phenyl-1,2,4-triazol-1-yl)acetamide (PubChem CID 11419248) has the molecular formula C20H22N6O2 and a molecular weight of 378.44 g/mol. Its IUPAC name is N-[(4-carbamimidoylphenyl)methyl]-2-ethoxy-2-(3-phenyl-1,2,4-triazol-1-yl)acetamide.
| Compound Name | N-[(4-carbamimidoylphenyl)methyl]-2-ethoxy-2-(3-phenyl-1,2,4-triazol-1-yl)acetamide |
|---|---|
| PubChem CID | 11419248 |
| Molecular Formula | C20H22N6O2 |
| Molecular Weight | 378.44 g/mol |
| Exact Mass | 378.18 |
| IUPAC Name | N-[(4-carbamimidoylphenyl)methyl]-2-ethoxy-2-(3-phenyl-1,2,4-triazol-1-yl)acetamide |
| SMILES | [H]/N=C(\N)c1ccc(CNC(=O)C(OCC)n2cnc(-c3ccccc3)n2)cc1 |
| InChI | InChI=1S/C20H22N6O2/c1-2-28-20(26-13-24-18(25-26)16-6-4-3-5-7-16)19(27)23-12-14-8-10-15(11-9-14)17(21)22/h3-11,13,20H,2,12H2,1H3,(H3,21,22)(H,23,27) |
| InChIKey | YFNQIZBDTOKBBL-UHFFFAOYSA-N |
| XLogP | 2.08 |
| TPSA | 118.91 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.44 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|