C27H29FN4O5 — CID 69288757
benzyl N-[5-carbamimidoyl-2-[[[2-ethoxy-2-(2-fluoro-4-methoxyphenyl)acetyl]amino]methyl]phenyl]carbamate (PubChem CID 69288757) has the molecular formula C27H29FN4O5 and a molecular weight of 508.55 g/mol. Its IUPAC name is benzyl N-[5-carbamimidoyl-2-[[[2-ethoxy-2-(2-fluoro-4-methoxyphenyl)acetyl]amino]methyl]phenyl]carbamate.
| Compound Name | benzyl N-[5-carbamimidoyl-2-[[[2-ethoxy-2-(2-fluoro-4-methoxyphenyl)acetyl]amino]methyl]phenyl]carbamate |
|---|---|
| PubChem CID | 69288757 |
| Molecular Formula | C27H29FN4O5 |
| Molecular Weight | 508.55 g/mol |
| Exact Mass | 508.21 |
| IUPAC Name | benzyl N-[5-carbamimidoyl-2-[[[2-ethoxy-2-(2-fluoro-4-methoxyphenyl)acetyl]amino]methyl]phenyl]carbamate |
| SMILES | [H]/N=C(\N)c1ccc(CNC(=O)C(OCC)c2ccc(OC)cc2F)c(NC(=O)OCc2ccccc2)c1 |
| InChI | InChI=1S/C27H29FN4O5/c1-3-36-24(21-12-11-20(35-2)14-22(21)28)26(33)31-15-19-10-9-18(25(29)30)13-23(19)32-27(34)37-16-17-7-5-4-6-8-17/h4-14,24H,3,15-16H2,1-2H3,(H3,29,30)(H,31,33)(H,32,34) |
| InChIKey | ZCNFJZSJDOONTC-UHFFFAOYSA-N |
| XLogP | 4.26 |
| TPSA | 135.76 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.55 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|