C21H24FN3O5 — CID 10024969
ethyl (NZ)-N-[amino-[4-[[[(2R)-2-(2-fluoro-4-methoxyphenyl)-2-methoxyacetyl]amino]methyl]phenyl]methylidene]carbamate (PubChem CID 10024969) has the molecular formula C21H24FN3O5 and a molecular weight of 417.44 g/mol. Its IUPAC name is ethyl (NZ)-N-[amino-[4-[[[(2R)-2-(2-fluoro-4-methoxyphenyl)-2-methoxyacetyl]amino]methyl]phenyl]methylidene]carbamate.
| Compound Name | ethyl (NZ)-N-[amino-[4-[[[(2R)-2-(2-fluoro-4-methoxyphenyl)-2-methoxyacetyl]amino]methyl]phenyl]methylidene]carbamate |
|---|---|
| PubChem CID | 10024969 |
| Molecular Formula | C21H24FN3O5 |
| Molecular Weight | 417.44 g/mol |
| Exact Mass | 417.17 |
| IUPAC Name | ethyl (NZ)-N-[amino-[4-[[[(2R)-2-(2-fluoro-4-methoxyphenyl)-2-methoxyacetyl]amino]methyl]phenyl]methylidene]carbamate |
| SMILES | CCOC(=O)/N=C(\N)c1ccc(CNC(=O)[C@H](OC)c2ccc(OC)cc2F)cc1 |
| InChI | InChI=1S/C21H24FN3O5/c1-4-30-21(27)25-19(23)14-7-5-13(6-8-14)12-24-20(26)18(29-3)16-10-9-15(28-2)11-17(16)22/h5-11,18H,4,12H2,1-3H3,(H,24,26)(H2,23,25,27)/t18-/m1/s1 |
| InChIKey | DQHCYASUSUULKJ-GOSISDBHSA-N |
| XLogP | 2.70 |
| TPSA | 112.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.44 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|